C16H18N2O4 — CID 135495095
4-[C-(2,4-dihydroxyphenyl)-N-(propylamino)carbonimidoyl]benzene-1,3-diol (PubChem CID 135495095) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[C-(2,4-dihydroxyphenyl)-N-(propylamino)carbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[C-(2,4-dihydroxyphenyl)-N-(propylamino)carbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135495095 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-[C-(2,4-dihydroxyphenyl)-N-(propylamino)carbonimidoyl]benzene-1,3-diol |
| SMILES | CCCNN=C(c1ccc(O)cc1O)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H18N2O4/c1-2-7-17-18-16(12-5-3-10(19)8-14(12)21)13-6-4-11(20)9-15(13)22/h3-6,8-9,17,19-22H,2,7H2,1H3 |
| InChIKey | JSXJJPQNDNHFCD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|