C15H23NO3 — CID 135679169
4-[(E)-N-hydroxy-C-octylcarbonimidoyl]benzene-1,3-diol (PubChem CID 135679169) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-[(E)-N-hydroxy-C-octylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[(E)-N-hydroxy-C-octylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135679169 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 4-[(E)-N-hydroxy-C-octylcarbonimidoyl]benzene-1,3-diol |
| SMILES | CCCCCCCC/C(=N\O)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H23NO3/c1-2-3-4-5-6-7-8-14(16-19)13-10-9-12(17)11-15(13)18/h9-11,17-19H,2-8H2,1H3/b16-14+ |
| InChIKey | DXRCRSKLDPCICE-JQIJEIRASA-N |
| XLogP | 4.03 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|