C10H13NO3 — CID 136848905
4-[(Z)-N-hydroxy-C-propylcarbonimidoyl]benzene-1,3-diol (PubChem CID 136848905) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-[(Z)-N-hydroxy-C-propylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[(Z)-N-hydroxy-C-propylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136848905 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 4-[(Z)-N-hydroxy-C-propylcarbonimidoyl]benzene-1,3-diol |
| SMILES | CCC/C(=N/O)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H13NO3/c1-2-3-9(11-14)8-5-4-7(12)6-10(8)13/h4-6,12-14H,2-3H2,1H3/b11-9- |
| InChIKey | YCKWYIRYEKQIRQ-LUAWRHEFSA-N |
| XLogP | 2.08 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|