C10H8N2O2S — CID 173321767
3-cyano-3-(2,4-dihydroxyphenyl)prop-2-enethioamide (PubChem CID 173321767) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-cyano-3-(2,4-dihydroxyphenyl)prop-2-enethioamide.
| Compound Name | 3-cyano-3-(2,4-dihydroxyphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 173321767 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3-cyano-3-(2,4-dihydroxyphenyl)prop-2-enethioamide |
| SMILES | N#CC(=CC(N)=S)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H8N2O2S/c11-5-6(3-10(12)15)8-2-1-7(13)4-9(8)14/h1-4,13-14H,(H2,12,15) |
| InChIKey | ZLMHMWLQFVIELQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|