C15H13Cl2N3O2S — CID 2406924
1-(3,4-dichlorophenyl)-3-[1-(2,4-dihydroxyphenyl)ethenylamino]thiourea (PubChem CID 2406924) has the molecular formula C15H13Cl2N3O2S and a molecular weight of 370.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[1-(2,4-dihydroxyphenyl)ethenylamino]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[1-(2,4-dihydroxyphenyl)ethenylamino]thiourea |
|---|---|
| PubChem CID | 2406924 |
| Molecular Formula | C15H13Cl2N3O2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[1-(2,4-dihydroxyphenyl)ethenylamino]thiourea |
| SMILES | C=C(NNC(=S)Nc1ccc(Cl)c(Cl)c1)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H13Cl2N3O2S/c1-8(11-4-3-10(21)7-14(11)22)19-20-15(23)18-9-2-5-12(16)13(17)6-9/h2-7,19,21-22H,1H2,(H2,18,20,23) |
| InChIKey | ZYCHIRHFXSFGDF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|