C14H11Cl2N3OS — CID 3658903
2-[(3,4-dichlorophenyl)carbamothioylamino]benzamide (PubChem CID 3658903) has the molecular formula C14H11Cl2N3OS and a molecular weight of 340.24 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamothioylamino]benzamide.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 3658903 |
| Molecular Formula | C14H11Cl2N3OS |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl2N3OS/c15-10-6-5-8(7-11(10)16)18-14(21)19-12-4-2-1-3-9(12)13(17)20/h1-7H,(H2,17,20)(H2,18,19,21) |
| InChIKey | IQGNJMDNARVRFE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|