C19H17Cl2N3S — CID 127042527
1-(3,4-dichlorophenyl)-3-[2-(2,5-dimethylpyrrol-1-yl)phenyl]thiourea (PubChem CID 127042527) has the molecular formula C19H17Cl2N3S and a molecular weight of 390.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(2,5-dimethylpyrrol-1-yl)phenyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(2,5-dimethylpyrrol-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 127042527 |
| Molecular Formula | C19H17Cl2N3S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(2,5-dimethylpyrrol-1-yl)phenyl]thiourea |
| SMILES | Cc1ccc(C)n1-c1ccccc1NC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H17Cl2N3S/c1-12-7-8-13(2)24(12)18-6-4-3-5-17(18)23-19(25)22-14-9-10-15(20)16(21)11-14/h3-11H,1-2H3,(H2,22,23,25) |
| InChIKey | ZCEPUYYLRPTOOI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|