C21H25Cl2N3S — CID 2803925
1-(7-amino-1,1,3,3,6-pentamethyl-2H-inden-5-yl)-3-(3,4-dichlorophenyl)thiourea (PubChem CID 2803925) has the molecular formula C21H25Cl2N3S and a molecular weight of 422.43 g/mol. Its IUPAC name is 1-(7-amino-1,1,3,3,6-pentamethyl-2H-inden-5-yl)-3-(3,4-dichlorophenyl)thiourea.
| Compound Name | 1-(7-amino-1,1,3,3,6-pentamethyl-2H-inden-5-yl)-3-(3,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 2803925 |
| Molecular Formula | C21H25Cl2N3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-(7-amino-1,1,3,3,6-pentamethyl-2H-inden-5-yl)-3-(3,4-dichlorophenyl)thiourea |
| SMILES | Cc1c(NC(=S)Nc2ccc(Cl)c(Cl)c2)cc2c(c1N)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C21H25Cl2N3S/c1-11-16(26-19(27)25-12-6-7-14(22)15(23)8-12)9-13-17(18(11)24)21(4,5)10-20(13,2)3/h6-9H,10,24H2,1-5H3,(H2,25,26,27) |
| InChIKey | BUTQAUVNQZMRGO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|