C13H10Cl3N3O — CID 27165302
1-(2-chloroanilino)-3-(3,4-dichlorophenyl)urea (PubChem CID 27165302) has the molecular formula C13H10Cl3N3O and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-(2-chloroanilino)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(2-chloroanilino)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 27165302 |
| Molecular Formula | C13H10Cl3N3O |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 1-(2-chloroanilino)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(NNc1ccccc1Cl)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3N3O/c14-9-6-5-8(7-11(9)16)17-13(20)19-18-12-4-2-1-3-10(12)15/h1-7,18H,(H2,17,19,20) |
| InChIKey | ISRNKQODUJZBGI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|