C11H9Cl2N5O — CID 59081759
1-(3,4-dichlorophenyl)-3-(pyrimidin-4-ylamino)urea (PubChem CID 59081759) has the molecular formula C11H9Cl2N5O and a molecular weight of 298.13 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(pyrimidin-4-ylamino)urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(pyrimidin-4-ylamino)urea |
|---|---|
| PubChem CID | 59081759 |
| Molecular Formula | C11H9Cl2N5O |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(pyrimidin-4-ylamino)urea |
| SMILES | O=C(NNc1ccncn1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl2N5O/c12-8-2-1-7(5-9(8)13)16-11(19)18-17-10-3-4-14-6-15-10/h1-6H,(H,14,15,17)(H2,16,18,19) |
| InChIKey | MIQOUIWPWATKBD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|