C19H14ClF3N4O — CID 59708654
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-pyridin-4-ylanilino)urea (PubChem CID 59708654) has the molecular formula C19H14ClF3N4O and a molecular weight of 406.80 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-pyridin-4-ylanilino)urea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-pyridin-4-ylanilino)urea |
|---|---|
| PubChem CID | 59708654 |
| Molecular Formula | C19H14ClF3N4O |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(4-pyridin-4-ylanilino)urea |
| SMILES | O=C(NNc1ccc(-c2ccncc2)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14ClF3N4O/c20-17-6-5-15(11-16(17)19(21,22)23)25-18(28)27-26-14-3-1-12(2-4-14)13-7-9-24-10-8-13/h1-11,26H,(H2,25,27,28) |
| InChIKey | JQTGFWKUHGPEJI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|