C13H10Cl2N4O3 — CID 9438160
1-(3,4-dichloroanilino)-3-(2-nitrophenyl)urea (PubChem CID 9438160) has the molecular formula C13H10Cl2N4O3 and a molecular weight of 341.15 g/mol. Its IUPAC name is 1-(3,4-dichloroanilino)-3-(2-nitrophenyl)urea.
| Compound Name | 1-(3,4-dichloroanilino)-3-(2-nitrophenyl)urea |
|---|---|
| PubChem CID | 9438160 |
| Molecular Formula | C13H10Cl2N4O3 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1-(3,4-dichloroanilino)-3-(2-nitrophenyl)urea |
| SMILES | O=C(NNc1ccc(Cl)c(Cl)c1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10Cl2N4O3/c14-9-6-5-8(7-10(9)15)17-18-13(20)16-11-3-1-2-4-12(11)19(21)22/h1-7,17H,(H2,16,18,20) |
| InChIKey | AGHXVOMGWZLGNN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|