C17H17NO7S — CID 19106230
5-[1-[[2-(benzenesulfonyl)acetyl]amino]ethoxy]-2-hydroxybenzoic acid (PubChem CID 19106230) has the molecular formula C17H17NO7S and a molecular weight of 379.39 g/mol. Its IUPAC name is 5-[1-[[2-(benzenesulfonyl)acetyl]amino]ethoxy]-2-hydroxybenzoic acid.
| Compound Name | 5-[1-[[2-(benzenesulfonyl)acetyl]amino]ethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19106230 |
| Molecular Formula | C17H17NO7S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-[1-[[2-(benzenesulfonyl)acetyl]amino]ethoxy]-2-hydroxybenzoic acid |
| SMILES | CC(NC(=O)CS(=O)(=O)c1ccccc1)Oc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H17NO7S/c1-11(25-12-7-8-15(19)14(9-12)17(21)22)18-16(20)10-26(23,24)13-5-3-2-4-6-13/h2-9,11,19H,10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | MHLGHGNYQHIRFT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|