About sodium;4-(4-aminophenyl)sulfonylaniline;cyanate
sodium;4-(4-aminophenyl)sulfonylaniline;cyanate (PubChem CID 67466349) has the molecular formula C13H12N3NaO3S
and a molecular weight of 313.31 g/mol. Its IUPAC name is sodium;4-(4-aminophenyl)sulfonylaniline;cyanate.
Molecular Properties
| Compound Name | sodium;4-(4-aminophenyl)sulfonylaniline;cyanate |
| PubChem CID | 67466349 |
| Molecular Formula | C13H12N3NaO3S |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | sodium;4-(4-aminophenyl)sulfonylaniline;cyanate |
| SMILES | N#C[O-].Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.[Na+] |
| InChI | InChI=1S/C12H12N2O2S.CHNO.Na/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;2-1-3;/h1-8H,13-14H2;3H;/q;;+1/p-1 |
| InChIKey | JDFXKWXQCKZIGH-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze sodium;4-(4-aminophenyl)sulfonylaniline;cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;4-(4-aminophenyl)sulfonylaniline;cyanate?
The IUPAC name of sodium;4-(4-aminophenyl)sulfonylaniline;cyanate (CID 67466349) is sodium;4-(4-aminophenyl)sulfonylaniline;cyanate.
What is the SMILES notation for sodium;4-(4-aminophenyl)sulfonylaniline;cyanate?
The canonical SMILES for sodium;4-(4-aminophenyl)sulfonylaniline;cyanate is N#C[O-].Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.[Na+].
What is the InChIKey of sodium;4-(4-aminophenyl)sulfonylaniline;cyanate?
The InChIKey is JDFXKWXQCKZIGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H12N2O2S.CHNO.Na/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;2-1-3;/h1-8H,13-14H2;3H;/q;;+1/p-1.
What are the key properties of sodium;4-(4-aminophenyl)sulfonylaniline;cyanate?
sodium;4-(4-aminophenyl)sulfonylaniline;cyanate has a molecular weight of 313.31 g/mol, XLogP of -2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;4-(4-aminophenyl)sulfonylaniline;cyanate is sourced from PubChem (CID 67466349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).