C24H20Cl2N2O6S3 — CID 88770219
4-(4-aminophenyl)sulfonylaniline;4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride (PubChem CID 88770219) has the molecular formula C24H20Cl2N2O6S3 and a molecular weight of 599.54 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonylaniline;4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride.
| Compound Name | 4-(4-aminophenyl)sulfonylaniline;4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 88770219 |
| Molecular Formula | C24H20Cl2N2O6S3 |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 597.99 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylaniline;4-(4-chlorosulfonylphenyl)benzenesulfonyl chloride |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.O=S(=O)(Cl)c1ccc(-c2ccc(S(=O)(=O)Cl)cc2)cc1 |
| InChI | InChI=1S/C12H8Cl2O4S2.C12H12N2O2S/c13-19(15,16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(14,17)18;13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8H;1-8H,13-14H2 |
| InChIKey | GVHDIDDNVAAIDF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|