About 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid
4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid (PubChem CID 506593) has the molecular formula C16H24N2O8S3
and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid |
| PubChem CID | 506593 |
| Molecular Formula | C16H24N2O8S3 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid |
| SMILES | CCS(=O)(=O)O.CCS(=O)(=O)O.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2O2S.2C2H6O3S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;2*1-2-6(3,4)5/h1-8H,13-14H2;2*2H2,1H3,(H,3,4,5) |
| InChIKey | GVUUVENPNWJILP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid?
The IUPAC name of 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid (CID 506593) is 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid.
What is the SMILES notation for 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid?
The canonical SMILES for 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid is CCS(=O)(=O)O.CCS(=O)(=O)O.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid?
The InChIKey is GVUUVENPNWJILP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S.2C2H6O3S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;2*1-2-6(3,4)5/h1-8H,13-14H2;2*2H2,1H3,(H,3,4,5).
What are the key properties of 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid?
4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid has a molecular weight of 468.58 g/mol, XLogP of 1.47, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)sulfonylaniline;ethanesulfonic acid is sourced from PubChem (CID 506593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).