C16H19NO2S3 — CID 23451836
4-[3,5-bis(ethylsulfanyl)phenyl]sulfonylaniline (PubChem CID 23451836) has the molecular formula C16H19NO2S3 and a molecular weight of 353.53 g/mol. Its IUPAC name is 4-[3,5-bis(ethylsulfanyl)phenyl]sulfonylaniline.
| Compound Name | 4-[3,5-bis(ethylsulfanyl)phenyl]sulfonylaniline |
|---|---|
| PubChem CID | 23451836 |
| Molecular Formula | C16H19NO2S3 |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-[3,5-bis(ethylsulfanyl)phenyl]sulfonylaniline |
| SMILES | CCSc1cc(SCC)cc(S(=O)(=O)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C16H19NO2S3/c1-3-20-13-9-14(21-4-2)11-16(10-13)22(18,19)15-7-5-12(17)6-8-15/h5-11H,3-4,17H2,1-2H3 |
| InChIKey | RLAQUROULJMGJP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|