C14H17ClN2O4S — CID 54607202
5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;hydrochloride (PubChem CID 54607202) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;hydrochloride.
| Compound Name | 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 54607202 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 5-(2-aminoethyl)-3-(4-aminophenyl)sulfonylbenzene-1,2-diol;hydrochloride |
| SMILES | Cl.NCCc1cc(O)c(O)c(S(=O)(=O)c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C14H16N2O4S.ClH/c15-6-5-9-7-12(17)14(18)13(8-9)21(19,20)11-3-1-10(16)2-4-11;/h1-4,7-8,17-18H,5-6,15-16H2;1H |
| InChIKey | RIOUWFLFMZUALI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|