C13H14N2O3S — CID 67377491
4-methyl-N-(4-methylsulfonylphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 67377491) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-methyl-N-(4-methylsulfonylphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 4-methyl-N-(4-methylsulfonylphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67377491 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-methyl-N-(4-methylsulfonylphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | Cc1c[nH]cc1C(=O)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H14N2O3S/c1-9-7-14-8-12(9)13(16)15-10-3-5-11(6-4-10)19(2,17)18/h3-8,14H,1-2H3,(H,15,16) |
| InChIKey | KWLXASSCJRDWRT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |