C14H15N3O3S — CID 146080206
4,6-dimethyl-N-(4-methylsulfonylphenyl)pyrimidine-2-carboxamide (PubChem CID 146080206) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4,6-dimethyl-N-(4-methylsulfonylphenyl)pyrimidine-2-carboxamide.
| Compound Name | 4,6-dimethyl-N-(4-methylsulfonylphenyl)pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 146080206 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4,6-dimethyl-N-(4-methylsulfonylphenyl)pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)nc(C(=O)Nc2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C14H15N3O3S/c1-9-8-10(2)16-13(15-9)14(18)17-11-4-6-12(7-5-11)21(3,19)20/h4-8H,1-3H3,(H,17,18) |
| InChIKey | DROZQQOLXKTEQH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |