C11H7Br2N3O3 — CID 136996675
N-(3,5-dibromopyrazin-2-yl)-2,3-dihydroxybenzamide (PubChem CID 136996675) has the molecular formula C11H7Br2N3O3 and a molecular weight of 389.00 g/mol. Its IUPAC name is N-(3,5-dibromopyrazin-2-yl)-2,3-dihydroxybenzamide.
| Compound Name | N-(3,5-dibromopyrazin-2-yl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 136996675 |
| Molecular Formula | C11H7Br2N3O3 |
| Molecular Weight | 389.00 g/mol |
| Exact Mass | 386.89 |
| IUPAC Name | N-(3,5-dibromopyrazin-2-yl)-2,3-dihydroxybenzamide |
| SMILES | O=C(Nc1ncc(Br)nc1Br)c1cccc(O)c1O |
| InChI | InChI=1S/C11H7Br2N3O3/c12-7-4-14-10(9(13)15-7)16-11(19)5-2-1-3-6(17)8(5)18/h1-4,17-18H,(H,14,16,19) |
| InChIKey | JMWUDKCSTGXPJR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.00 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|