C18H13F3N4O2 — CID 118385340
3-amino-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 118385340) has the molecular formula C18H13F3N4O2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 3-amino-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-amino-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 118385340 |
| Molecular Formula | C18H13F3N4O2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-amino-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | Nc1cc(C(=O)Nc2ncc(-c3ccccc3)cn2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C18H13F3N4O2/c19-18(20,21)27-15-7-6-12(8-14(15)22)16(26)25-17-23-9-13(10-24-17)11-4-2-1-3-5-11/h1-10H,22H2,(H,23,24,25,26) |
| InChIKey | DUGABYXUDKRACX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|