C14H9F3N6O2S — CID 118385774
3-amino-N-(5-pyrimidin-5-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 118385774) has the molecular formula C14H9F3N6O2S and a molecular weight of 382.33 g/mol. Its IUPAC name is 3-amino-N-(5-pyrimidin-5-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-amino-N-(5-pyrimidin-5-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 118385774 |
| Molecular Formula | C14H9F3N6O2S |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-amino-N-(5-pyrimidin-5-yl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | Nc1cc(C(=O)Nc2nnc(-c3cncnc3)s2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C14H9F3N6O2S/c15-14(16,17)25-10-2-1-7(3-9(10)18)11(24)21-13-23-22-12(26-13)8-4-19-6-20-5-8/h1-6H,18H2,(H,21,23,24) |
| InChIKey | HPKQOSPNYQILHP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|