C20H14ClF3N4O3 — CID 118385290
3-[(2-chloroacetyl)amino]-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 118385290) has the molecular formula C20H14ClF3N4O3 and a molecular weight of 450.80 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-[(2-chloroacetyl)amino]-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 118385290 |
| Molecular Formula | C20H14ClF3N4O3 |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]-N-(5-phenylpyrimidin-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(CCl)Nc1cc(C(=O)Nc2ncc(-c3ccccc3)cn2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C20H14ClF3N4O3/c21-9-17(29)27-15-8-13(6-7-16(15)31-20(22,23)24)18(30)28-19-25-10-14(11-26-19)12-4-2-1-3-5-12/h1-8,10-11H,9H2,(H,27,29)(H,25,26,28,30) |
| InChIKey | JPXXBAAXJWUILQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|