C14H5Cl4F3O2 — CID 21463663
3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride (PubChem CID 21463663) has the molecular formula C14H5Cl4F3O2 and a molecular weight of 404.00 g/mol. Its IUPAC name is 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride.
| Compound Name | 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride |
|---|---|
| PubChem CID | 21463663 |
| Molecular Formula | C14H5Cl4F3O2 |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H5Cl4F3O2/c15-8-3-6(13(18)22)1-2-11(8)23-12-9(16)4-7(5-10(12)17)14(19,20)21/h1-5H |
| InChIKey | XULAMPSKDUCXLJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|