About 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride
3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride (PubChem CID 21463663) has the molecular formula C14H5Cl4F3O2
and a molecular weight of 404.00 g/mol. Its IUPAC name is 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride.
Molecular Properties
| Compound Name | 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride |
| PubChem CID | 21463663 |
| Molecular Formula | C14H5Cl4F3O2 |
| Molecular Weight | 404.00 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H5Cl4F3O2/c15-8-3-6(13(18)22)1-2-11(8)23-12-9(16)4-7(5-10(12)17)14(19,20)21/h1-5H |
| InChIKey | XULAMPSKDUCXLJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.00 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride?
The IUPAC name of 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride (CID 21463663) is 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride.
What is the SMILES notation for 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride?
The canonical SMILES for 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride is O=C(Cl)c1ccc(Oc2c(Cl)cc(C(F)(F)F)cc2Cl)c(Cl)c1.
What is the InChIKey of 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride?
The InChIKey is XULAMPSKDUCXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5Cl4F3O2/c15-8-3-6(13(18)22)1-2-11(8)23-12-9(16)4-7(5-10(12)17)14(19,20)21/h1-5H.
What are the key properties of 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride?
3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride has a molecular weight of 404.00 g/mol, XLogP of 6.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[2,6-dichloro-4-(trifluoromethyl)phenoxy]benzoyl chloride is sourced from PubChem (CID 21463663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).