C11H3Cl2F7O3 — CID 139767861
5-(1,1,2,2,3,3,3-heptafluoropropoxy)benzene-1,3-dicarbonyl chloride (PubChem CID 139767861) has the molecular formula C11H3Cl2F7O3 and a molecular weight of 387.03 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropoxy)benzene-1,3-dicarbonyl chloride.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropoxy)benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 139767861 |
| Molecular Formula | C11H3Cl2F7O3 |
| Molecular Weight | 387.03 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropoxy)benzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cc(OC(F)(F)C(F)(F)C(F)(F)F)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C11H3Cl2F7O3/c12-7(21)4-1-5(8(13)22)3-6(2-4)23-11(19,20)9(14,15)10(16,17)18/h1-3H |
| InChIKey | BYYFQHAINLESRH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|