C9H3Cl2CsF4O3 — CID 134828496
cesium 3-(2,4-dichlorophenoxy)-2,2,3,3-tetrafluoropropanoate (PubChem CID 134828496) has the molecular formula C9H3Cl2CsF4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is cesium 3-(2,4-dichlorophenoxy)-2,2,3,3-tetrafluoropropanoate.
| Compound Name | cesium 3-(2,4-dichlorophenoxy)-2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 134828496 |
| Molecular Formula | C9H3Cl2CsF4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | cesium 3-(2,4-dichlorophenoxy)-2,2,3,3-tetrafluoropropanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)Oc1ccc(Cl)cc1Cl.[Cs+] |
| InChI | InChI=1S/C9H4Cl2F4O3.Cs/c10-4-1-2-6(5(11)3-4)18-9(14,15)8(12,13)7(16)17;/h1-3H,(H,16,17);/q;+1/p-1 |
| InChIKey | ZXGHXAZLZMXFEL-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|