C11H12Cl2F4OSi — CID 154731418
[2-(2,4-dichlorophenoxy)-1,1,2,2-tetrafluoroethyl]-trimethylsilane (PubChem CID 154731418) has the molecular formula C11H12Cl2F4OSi and a molecular weight of 335.20 g/mol. Its IUPAC name is [2-(2,4-dichlorophenoxy)-1,1,2,2-tetrafluoroethyl]-trimethylsilane.
| Compound Name | [2-(2,4-dichlorophenoxy)-1,1,2,2-tetrafluoroethyl]-trimethylsilane |
|---|---|
| PubChem CID | 154731418 |
| Molecular Formula | C11H12Cl2F4OSi |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | [2-(2,4-dichlorophenoxy)-1,1,2,2-tetrafluoroethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(F)(F)C(F)(F)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2F4OSi/c1-19(2,3)11(16,17)10(14,15)18-9-5-4-7(12)6-8(9)13/h4-6H,1-3H3 |
| InChIKey | RXGLIMXWKPNLKS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|