C7H6Cl2O — CID 141358841
2,4-dichloro-1-(trideuteriomethoxy)benzene (PubChem CID 141358841) has the molecular formula C7H6Cl2O and a molecular weight of 180.05 g/mol. Its IUPAC name is 2,4-dichloro-1-(trideuteriomethoxy)benzene.
| Compound Name | 2,4-dichloro-1-(trideuteriomethoxy)benzene |
|---|---|
| PubChem CID | 141358841 |
| Molecular Formula | C7H6Cl2O |
| Molecular Weight | 180.05 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | 2,4-dichloro-1-(trideuteriomethoxy)benzene |
| SMILES | [2H]C([2H])([2H])Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl2O/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3/i1D3 |
| InChIKey | CICQUFBZCADHHX-FIBGUPNXSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.05 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |