About (2,4-dichlorophenyl) methanimidate
(2,4-dichlorophenyl) methanimidate (PubChem CID 45091448) has the molecular formula C7H5Cl2NO
and a molecular weight of 190.03 g/mol. Its IUPAC name is (2,4-dichlorophenyl) methanimidate.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl) methanimidate |
| PubChem CID | 45091448 |
| Molecular Formula | C7H5Cl2NO |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.97 |
| IUPAC Name | (2,4-dichlorophenyl) methanimidate |
| SMILES | [H]/N=C/Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2NO/c8-5-1-2-7(11-4-10)6(9)3-5/h1-4,10H/b10-4+ |
| InChIKey | WZVBTUVYHLWVLP-ONNFQVAWSA-N |
| XLogP | 2.98 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichlorophenyl) methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl) methanimidate?
The IUPAC name of (2,4-dichlorophenyl) methanimidate (CID 45091448) is (2,4-dichlorophenyl) methanimidate.
What is the SMILES notation for (2,4-dichlorophenyl) methanimidate?
The canonical SMILES for (2,4-dichlorophenyl) methanimidate is [H]/N=C/Oc1ccc(Cl)cc1Cl.
What is the InChIKey of (2,4-dichlorophenyl) methanimidate?
The InChIKey is WZVBTUVYHLWVLP-ONNFQVAWSA-N. The full InChI is InChI=1S/C7H5Cl2NO/c8-5-1-2-7(11-4-10)6(9)3-5/h1-4,10H/b10-4+.
What are the key properties of (2,4-dichlorophenyl) methanimidate?
(2,4-dichlorophenyl) methanimidate has a molecular weight of 190.03 g/mol, XLogP of 2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl) methanimidate is sourced from PubChem (CID 45091448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).