C15H12Cl4O2Si — CID 163490244
bis(2,4-dichlorophenoxy)-prop-1-enylsilane (PubChem CID 163490244) has the molecular formula C15H12Cl4O2Si and a molecular weight of 394.16 g/mol. Its IUPAC name is bis(2,4-dichlorophenoxy)-prop-1-enylsilane.
| Compound Name | bis(2,4-dichlorophenoxy)-prop-1-enylsilane |
|---|---|
| PubChem CID | 163490244 |
| Molecular Formula | C15H12Cl4O2Si |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | bis(2,4-dichlorophenoxy)-prop-1-enylsilane |
| SMILES | CC=C[SiH](Oc1ccc(Cl)cc1Cl)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl4O2Si/c1-2-7-22(20-14-5-3-10(16)8-12(14)18)21-15-6-4-11(17)9-13(15)19/h2-9,22H,1H3 |
| InChIKey | CLZGJPSWWQSDPW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|