About (2-chloro-4-ethylphenyl) methanimidate
(2-chloro-4-ethylphenyl) methanimidate (PubChem CID 122643512) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is (2-chloro-4-ethylphenyl) methanimidate.
Molecular Properties
| Compound Name | (2-chloro-4-ethylphenyl) methanimidate |
| PubChem CID | 122643512 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (2-chloro-4-ethylphenyl) methanimidate |
| SMILES | [H]/N=C/Oc1ccc(CC)cc1Cl |
| InChI | InChI=1S/C9H10ClNO/c1-2-7-3-4-9(12-6-11)8(10)5-7/h3-6,11H,2H2,1H3/b11-6+ |
| InChIKey | REDLSEWASSSUNN-IZZDOVSWSA-N |
| XLogP | 2.89 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-ethylphenyl) methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-ethylphenyl) methanimidate?
The IUPAC name of (2-chloro-4-ethylphenyl) methanimidate (CID 122643512) is (2-chloro-4-ethylphenyl) methanimidate.
What is the SMILES notation for (2-chloro-4-ethylphenyl) methanimidate?
The canonical SMILES for (2-chloro-4-ethylphenyl) methanimidate is [H]/N=C/Oc1ccc(CC)cc1Cl.
What is the InChIKey of (2-chloro-4-ethylphenyl) methanimidate?
The InChIKey is REDLSEWASSSUNN-IZZDOVSWSA-N. The full InChI is InChI=1S/C9H10ClNO/c1-2-7-3-4-9(12-6-11)8(10)5-7/h3-6,11H,2H2,1H3/b11-6+.
What are the key properties of (2-chloro-4-ethylphenyl) methanimidate?
(2-chloro-4-ethylphenyl) methanimidate has a molecular weight of 183.64 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-ethylphenyl) methanimidate is sourced from PubChem (CID 122643512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).