C9H6Cl2F4N2O2 — CID 174687505
1-chloro-3-[3-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea (PubChem CID 174687505) has the molecular formula C9H6Cl2F4N2O2 and a molecular weight of 321.06 g/mol. Its IUPAC name is 1-chloro-3-[3-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea.
| Compound Name | 1-chloro-3-[3-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 174687505 |
| Molecular Formula | C9H6Cl2F4N2O2 |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | 1-chloro-3-[3-chloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| SMILES | O=C(NCl)Nc1ccc(OC(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2F4N2O2/c10-5-3-4(16-8(18)17-11)1-2-6(5)19-9(14,15)7(12)13/h1-3,7H,(H2,16,17,18) |
| InChIKey | BISMTIBVPRKLPQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|