C23H6F37NO3S — CID 16657962
3,5-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)aniline;trifluoromethanesulfonic acid (PubChem CID 16657962) has the molecular formula C23H6F37NO3S and a molecular weight of 1079.30 g/mol. Its IUPAC name is 3,5-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)aniline;trifluoromethanesulfonic acid.
| Compound Name | 3,5-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)aniline;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 16657962 |
| Molecular Formula | C23H6F37NO3S |
| Molecular Weight | 1079.30 g/mol |
| Exact Mass | 1078.95 |
| IUPAC Name | 3,5-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)aniline;trifluoromethanesulfonic acid |
| SMILES | Nc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C22H5F34N.CHF3O3S/c23-7(24,9(27,28)11(31,32)13(35,36)15(39,40)17(43,44)19(47,48)21(51,52)53)4-1-5(3-6(57)2-4)8(25,26)10(29,30)12(33,34)14(37,38)16(41,42)18(45,46)20(49,50)22(54,55)56;2-1(3,4)8(5,6)7/h1-3H,57H2;(H,5,6,7) |
| InChIKey | XTZGYMFHBBATAZ-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.30 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|