C26H19F3O2 — CID 164897791
4-[2,2,2-trifluoro-1-(4-hydroxyphenyl)-1-(4-phenylphenyl)ethyl]phenol (PubChem CID 164897791) has the molecular formula C26H19F3O2 and a molecular weight of 420.43 g/mol. Its IUPAC name is 4-[2,2,2-trifluoro-1-(4-hydroxyphenyl)-1-(4-phenylphenyl)ethyl]phenol.
| Compound Name | 4-[2,2,2-trifluoro-1-(4-hydroxyphenyl)-1-(4-phenylphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 164897791 |
| Molecular Formula | C26H19F3O2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[2,2,2-trifluoro-1-(4-hydroxyphenyl)-1-(4-phenylphenyl)ethyl]phenol |
| SMILES | Oc1ccc(C(c2ccc(O)cc2)(c2ccc(-c3ccccc3)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H19F3O2/c27-26(28,29)25(21-10-14-23(30)15-11-21,22-12-16-24(31)17-13-22)20-8-6-19(7-9-20)18-4-2-1-3-5-18/h1-17,30-31H |
| InChIKey | WHWHLTAJNMBQAQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|