C14H11F5O2S — CID 162511625
2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-thiophen-3-ylpropan-1-ol (PubChem CID 162511625) has the molecular formula C14H11F5O2S and a molecular weight of 338.30 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-thiophen-3-ylpropan-1-ol.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-thiophen-3-ylpropan-1-ol |
|---|---|
| PubChem CID | 162511625 |
| Molecular Formula | C14H11F5O2S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-methoxyphenyl)-1-thiophen-3-ylpropan-1-ol |
| SMILES | COc1ccc(C(O)(c2ccsc2)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F5O2S/c1-21-11-4-2-9(3-5-11)12(20,10-6-7-22-8-10)13(15,16)14(17,18)19/h2-8,20H,1H3 |
| InChIKey | YABKFHHLRGFSPY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|