C9H6F6O4S3 — CID 162538123
bis(trifluoromethylsulfonyl)methylsulfanylbenzene (PubChem CID 162538123) has the molecular formula C9H6F6O4S3 and a molecular weight of 388.33 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)methylsulfanylbenzene.
| Compound Name | bis(trifluoromethylsulfonyl)methylsulfanylbenzene |
|---|---|
| PubChem CID | 162538123 |
| Molecular Formula | C9H6F6O4S3 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | bis(trifluoromethylsulfonyl)methylsulfanylbenzene |
| SMILES | O=S(=O)(C(Sc1ccccc1)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F6O4S3/c10-8(11,12)21(16,17)7(22(18,19)9(13,14)15)20-6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | UWBSGZJFSBYNTD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |