C14H20F2O2S — CID 163297808
(3-ethyl-1,1-difluoro-2-methylpentyl)sulfonylbenzene (PubChem CID 163297808) has the molecular formula C14H20F2O2S and a molecular weight of 290.37 g/mol. Its IUPAC name is (3-ethyl-1,1-difluoro-2-methylpentyl)sulfonylbenzene.
| Compound Name | (3-ethyl-1,1-difluoro-2-methylpentyl)sulfonylbenzene |
|---|---|
| PubChem CID | 163297808 |
| Molecular Formula | C14H20F2O2S |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (3-ethyl-1,1-difluoro-2-methylpentyl)sulfonylbenzene |
| SMILES | CCC(CC)C(C)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20F2O2S/c1-4-12(5-2)11(3)14(15,16)19(17,18)13-9-7-6-8-10-13/h6-12H,4-5H2,1-3H3 |
| InChIKey | ZCUVJLBWGKIJKK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |