C13H18F2O2S — CID 163297721
(1,1-difluoro-4-methylhexyl)sulfonylbenzene (PubChem CID 163297721) has the molecular formula C13H18F2O2S and a molecular weight of 276.35 g/mol. Its IUPAC name is (1,1-difluoro-4-methylhexyl)sulfonylbenzene.
| Compound Name | (1,1-difluoro-4-methylhexyl)sulfonylbenzene |
|---|---|
| PubChem CID | 163297721 |
| Molecular Formula | C13H18F2O2S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1,1-difluoro-4-methylhexyl)sulfonylbenzene |
| SMILES | CCC(C)CCC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18F2O2S/c1-3-11(2)9-10-13(14,15)18(16,17)12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3 |
| InChIKey | HRKDGDJMLFTWJY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |