C13H11F3O3S — CID 24785396
5,5,6-trifluoro-6-(4-methylphenyl)sulfonyl-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 24785396) has the molecular formula C13H11F3O3S and a molecular weight of 304.29 g/mol. Its IUPAC name is 5,5,6-trifluoro-6-(4-methylphenyl)sulfonyl-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,5,6-trifluoro-6-(4-methylphenyl)sulfonyl-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 24785396 |
| Molecular Formula | C13H11F3O3S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 5,5,6-trifluoro-6-(4-methylphenyl)sulfonyl-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | Cc1ccc(S(=O)(=O)C2(F)C3C=CC(O3)C2(F)F)cc1 |
| InChI | InChI=1S/C13H11F3O3S/c1-8-2-4-9(5-3-8)20(17,18)13(16)11-7-6-10(19-11)12(13,14)15/h2-7,10-11H,1H3 |
| InChIKey | OSBSWLHWNGDNJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|