About hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane
hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane (PubChem CID 164671246) has the molecular formula C15H24O2S
and a molecular weight of 268.42 g/mol. Its IUPAC name is hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane.
Molecular Properties
| Compound Name | hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane |
| PubChem CID | 164671246 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane |
| SMILES | COC1CCCCC1S(C)(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H24O2S/c1-12-8-10-13(11-9-12)18(3,16)15-7-5-4-6-14(15)17-2/h8-11,14-16H,4-7H2,1-3H3 |
| InChIKey | ILXXCRPLDWPKTE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane?
The IUPAC name of hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane (CID 164671246) is hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane.
What is the SMILES notation for hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane?
The canonical SMILES for hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane is COC1CCCCC1S(C)(O)c1ccc(C)cc1.
What is the InChIKey of hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane?
The InChIKey is ILXXCRPLDWPKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O2S/c1-12-8-10-13(11-9-12)18(3,16)15-7-5-4-6-14(15)17-2/h8-11,14-16H,4-7H2,1-3H3.
What are the key properties of hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane?
hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane has a molecular weight of 268.42 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(2-methoxycyclohexyl)-methyl-(4-methylphenyl)-λ4-sulfane is sourced from PubChem (CID 164671246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).