C20H23NO2S — CID 11221529
(1S,2R,10S,11R)-6-(4-methylphenyl)sulfonyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-3,8-diene (PubChem CID 11221529) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is (1S,2R,10S,11R)-6-(4-methylphenyl)sulfonyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-3,8-diene.
| Compound Name | (1S,2R,10S,11R)-6-(4-methylphenyl)sulfonyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-3,8-diene |
|---|---|
| PubChem CID | 11221529 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (1S,2R,10S,11R)-6-(4-methylphenyl)sulfonyl-6-azatetracyclo[9.2.1.02,10.04,8]tetradeca-3,8-diene |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C[C@@H]4[C@H]5CC[C@H](C5)[C@@H]4C=C3C2)cc1 |
| InChI | InChI=1S/C20H23NO2S/c1-13-2-6-18(7-3-13)24(22,23)21-11-16-9-19-14-4-5-15(8-14)20(19)10-17(16)12-21/h2-3,6-7,9-10,14-15,19-20H,4-5,8,11-12H2,1H3/t14-,15+,19+,20- |
| InChIKey | DEDIMFLWLGBKTH-FYXYJPLOSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |