C13H13F3O3S — CID 106584689
3-[2-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-one (PubChem CID 106584689) has the molecular formula C13H13F3O3S and a molecular weight of 306.30 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-one.
| Compound Name | 3-[2-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-one |
|---|---|
| PubChem CID | 106584689 |
| Molecular Formula | C13H13F3O3S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-[2-(trifluoromethyl)phenyl]sulfonylcyclohexan-1-one |
| SMILES | O=C1CCCC(S(=O)(=O)c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H13F3O3S/c14-13(15,16)11-6-1-2-7-12(11)20(18,19)10-5-3-4-9(17)8-10/h1-2,6-7,10H,3-5,8H2 |
| InChIKey | BISZHPJDXBNTGX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |