C11H12F3NO2S — CID 71108110
(2R)-2-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine (PubChem CID 71108110) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is (2R)-2-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine.
| Compound Name | (2R)-2-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 71108110 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (2R)-2-[2-(trifluoromethyl)phenyl]sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccccc1C(F)(F)F)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H12F3NO2S/c12-11(13,14)8-4-1-2-5-9(8)18(16,17)10-6-3-7-15-10/h1-2,4-5,10,15H,3,6-7H2/t10-/m1/s1 |
| InChIKey | DPISQBMNWUTICT-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |