About carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene
carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene (PubChem CID 90107384) has the molecular formula C17H21F3O6S
and a molecular weight of 410.41 g/mol. Its IUPAC name is carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene |
| PubChem CID | 90107384 |
| Molecular Formula | C17H21F3O6S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene |
| SMILES | O=C(O)O.O=S(=O)(c1ccccc1C(F)(F)F)[C@H]1CC[C@H](OC2CCC2)C1 |
| InChI | InChI=1S/C16H19F3O3S.CH2O3/c17-16(18,19)14-6-1-2-7-15(14)23(20,21)13-9-8-12(10-13)22-11-4-3-5-11;2-1(3)4/h1-2,6-7,11-13H,3-5,8-10H2;(H2,2,3,4)/t12-,13-;/m0./s1 |
| InChIKey | AHTAOMBOGBEPNV-QNTKWALQSA-N |
| XLogP | 4.19 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene?
The IUPAC name of carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene (CID 90107384) is carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene.
What is the SMILES notation for carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene?
The canonical SMILES for carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene is O=C(O)O.O=S(=O)(c1ccccc1C(F)(F)F)[C@H]1CC[C@H](OC2CCC2)C1.
What is the InChIKey of carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene?
The InChIKey is AHTAOMBOGBEPNV-QNTKWALQSA-N. The full InChI is InChI=1S/C16H19F3O3S.CH2O3/c17-16(18,19)14-6-1-2-7-15(14)23(20,21)13-9-8-12(10-13)22-11-4-3-5-11;2-1(3)4/h1-2,6-7,11-13H,3-5,8-10H2;(H2,2,3,4)/t12-,13-;/m0./s1.
What are the key properties of carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene?
carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene has a molecular weight of 410.41 g/mol, XLogP of 4.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-[(1S,3S)-3-cyclobutyloxycyclopentyl]sulfonyl-2-(trifluoromethyl)benzene is sourced from PubChem (CID 90107384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).