C13H12F3LiO4S — CID 173031965
lithium;hydride;4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentene-1-carboxylic acid (PubChem CID 173031965) has the molecular formula C13H12F3LiO4S and a molecular weight of 328.24 g/mol. Its IUPAC name is lithium;hydride;4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentene-1-carboxylic acid.
| Compound Name | lithium;hydride;4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 173031965 |
| Molecular Formula | C13H12F3LiO4S |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | lithium;hydride;4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentene-1-carboxylic acid |
| SMILES | O=C(O)C1=CCC(S(=O)(=O)c2ccccc2C(F)(F)F)C1.[H-].[Li+] |
| InChI | InChI=1S/C13H11F3O4S.Li.H/c14-13(15,16)10-3-1-2-4-11(10)21(19,20)9-6-5-8(7-9)12(17)18;;/h1-5,9H,6-7H2,(H,17,18);;/q;+1;-1 |
| InChIKey | ARKOSORSBJHCSB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |