C16H14BrF3O2S — CID 159116959
1-[3-(3-bromophenyl)propylsulfonyl]-2-(trifluoromethyl)benzene (PubChem CID 159116959) has the molecular formula C16H14BrF3O2S and a molecular weight of 407.25 g/mol. Its IUPAC name is 1-[3-(3-bromophenyl)propylsulfonyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1-[3-(3-bromophenyl)propylsulfonyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 159116959 |
| Molecular Formula | C16H14BrF3O2S |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 1-[3-(3-bromophenyl)propylsulfonyl]-2-(trifluoromethyl)benzene |
| SMILES | O=S(=O)(CCCc1cccc(Br)c1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H14BrF3O2S/c17-13-7-3-5-12(11-13)6-4-10-23(21,22)15-9-2-1-8-14(15)16(18,19)20/h1-3,5,7-9,11H,4,6,10H2 |
| InChIKey | KFFAXVKRUGMYSV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |