C22H20F3NO2S — CID 159092652
3-methyl-4-[3-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]phenyl]pyridine (PubChem CID 159092652) has the molecular formula C22H20F3NO2S and a molecular weight of 419.47 g/mol. Its IUPAC name is 3-methyl-4-[3-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]phenyl]pyridine.
| Compound Name | 3-methyl-4-[3-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]phenyl]pyridine |
|---|---|
| PubChem CID | 159092652 |
| Molecular Formula | C22H20F3NO2S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-methyl-4-[3-[3-[2-(trifluoromethyl)phenyl]sulfonylpropyl]phenyl]pyridine |
| SMILES | Cc1cnccc1-c1cccc(CCCS(=O)(=O)c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F3NO2S/c1-16-15-26-12-11-19(16)18-8-4-6-17(14-18)7-5-13-29(27,28)21-10-3-2-9-20(21)22(23,24)25/h2-4,6,8-12,14-15H,5,7,13H2,1H3 |
| InChIKey | KCGMKTRFMMBCIR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |