C9H7BrClF3O4S2 — CID 107289885
2-[5-bromo-2-(trifluoromethyl)phenyl]sulfonylethanesulfonyl chloride (PubChem CID 107289885) has the molecular formula C9H7BrClF3O4S2 and a molecular weight of 415.64 g/mol. Its IUPAC name is 2-[5-bromo-2-(trifluoromethyl)phenyl]sulfonylethanesulfonyl chloride.
| Compound Name | 2-[5-bromo-2-(trifluoromethyl)phenyl]sulfonylethanesulfonyl chloride |
|---|---|
| PubChem CID | 107289885 |
| Molecular Formula | C9H7BrClF3O4S2 |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 413.86 |
| IUPAC Name | 2-[5-bromo-2-(trifluoromethyl)phenyl]sulfonylethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCS(=O)(=O)c1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C9H7BrClF3O4S2/c10-6-1-2-7(9(12,13)14)8(5-6)19(15,16)3-4-20(11,17)18/h1-2,5H,3-4H2 |
| InChIKey | HTTLYQWAIGDRIP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |