C11H13F3N2 — CID 115628581
N-[(E)-pent-3-enyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 115628581) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(E)-pent-3-enyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115628581 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | N-[(E)-pent-3-enyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | C/C=C/CCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2/c1-2-3-4-7-15-10-9(11(12,13)14)6-5-8-16-10/h2-3,5-6,8H,4,7H2,1H3,(H,15,16)/b3-2+ |
| InChIKey | ZCQGPEQLKVISEB-NSCUHMNNSA-N |
| XLogP | 3.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|